C24H38N2O3 — CID 56552338
N-[[1-(2-methoxyphenyl)cyclopentyl]methyl]-N',N'-dipropylpentanediamide (PubChem CID 56552338) has the molecular formula C24H38N2O3 and a molecular weight of 402.58 g/mol. Its IUPAC name is N-[[1-(2-methoxyphenyl)cyclopentyl]methyl]-N',N'-dipropylpentanediamide.
| Compound Name | N-[[1-(2-methoxyphenyl)cyclopentyl]methyl]-N',N'-dipropylpentanediamide |
|---|---|
| PubChem CID | 56552338 |
| Molecular Formula | C24H38N2O3 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.29 |
| IUPAC Name | N-[[1-(2-methoxyphenyl)cyclopentyl]methyl]-N',N'-dipropylpentanediamide |
| SMILES | CCCN(CCC)C(=O)CCCC(=O)NCC1(c2ccccc2OC)CCCC1 |
| InChI | InChI=1S/C24H38N2O3/c1-4-17-26(18-5-2)23(28)14-10-13-22(27)25-19-24(15-8-9-16-24)20-11-6-7-12-21(20)29-3/h6-7,11-12H,4-5,8-10,13-19H2,1-3H3,(H,25,27) |
| InChIKey | CVTVPRXJLRKKOS-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |