C22H36N2O6 — CID 56552786
N-[3-(2,6-dimethoxyphenoxy)-2-hydroxypropyl]-N',N'-dipropylpentanediamide (PubChem CID 56552786) has the molecular formula C22H36N2O6 and a molecular weight of 424.54 g/mol. Its IUPAC name is N-[3-(2,6-dimethoxyphenoxy)-2-hydroxypropyl]-N',N'-dipropylpentanediamide.
| Compound Name | N-[3-(2,6-dimethoxyphenoxy)-2-hydroxypropyl]-N',N'-dipropylpentanediamide |
|---|---|
| PubChem CID | 56552786 |
| Molecular Formula | C22H36N2O6 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | N-[3-(2,6-dimethoxyphenoxy)-2-hydroxypropyl]-N',N'-dipropylpentanediamide |
| SMILES | CCCN(CCC)C(=O)CCCC(=O)NCC(O)COc1c(OC)cccc1OC |
| InChI | InChI=1S/C22H36N2O6/c1-5-13-24(14-6-2)21(27)12-8-11-20(26)23-15-17(25)16-30-22-18(28-3)9-7-10-19(22)29-4/h7,9-10,17,25H,5-6,8,11-16H2,1-4H3,(H,23,26) |
| InChIKey | VSHXHQKOFSFBOY-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |