C16H19FN2O3S — CID 84587895
1-(5-fluoro-3-pyridinyl)-N-[2-(4-methylsulfonylphenoxy)ethyl]ethanamine (PubChem CID 84587895) has the molecular formula C16H19FN2O3S and a molecular weight of 338.40 g/mol. Its IUPAC name is 1-(5-fluoro-3-pyridinyl)-N-[2-(4-methylsulfonylphenoxy)ethyl]ethanamine.
| Compound Name | 1-(5-fluoro-3-pyridinyl)-N-[2-(4-methylsulfonylphenoxy)ethyl]ethanamine |
|---|---|
| PubChem CID | 84587895 |
| Molecular Formula | C16H19FN2O3S |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 1-(5-fluoro-3-pyridinyl)-N-[2-(4-methylsulfonylphenoxy)ethyl]ethanamine |
| SMILES | CC(NCCOc1ccc(S(C)(=O)=O)cc1)c1cncc(F)c1 |
| InChI | InChI=1S/C16H19FN2O3S/c1-12(13-9-14(17)11-18-10-13)19-7-8-22-15-3-5-16(6-4-15)23(2,20)21/h3-6,9-12,19H,7-8H2,1-2H3 |
| InChIKey | KQZDSJQZLJOAGU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|