C17H21FN2O3 — CID 84588477
methyl 1-[[2-(3-fluorophenyl)cyclopropyl]carbamoyl]-3-methylpyrrolidine-3-carboxylate (PubChem CID 84588477) has the molecular formula C17H21FN2O3 and a molecular weight of 320.36 g/mol. Its IUPAC name is methyl 1-[[2-(3-fluorophenyl)cyclopropyl]carbamoyl]-3-methylpyrrolidine-3-carboxylate.
| Compound Name | methyl 1-[[2-(3-fluorophenyl)cyclopropyl]carbamoyl]-3-methylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 84588477 |
| Molecular Formula | C17H21FN2O3 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | methyl 1-[[2-(3-fluorophenyl)cyclopropyl]carbamoyl]-3-methylpyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1(C)CCN(C(=O)NC2CC2c2cccc(F)c2)C1 |
| InChI | InChI=1S/C17H21FN2O3/c1-17(15(21)23-2)6-7-20(10-17)16(22)19-14-9-13(14)11-4-3-5-12(18)8-11/h3-5,8,13-14H,6-7,9-10H2,1-2H3,(H,19,22) |
| InChIKey | WNSMJAHZCGFVIQ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |