C13H18N2O3S2 — CID 84589582
2-[2-[[ethyl(methyl)sulfamoyl]amino]-1-hydroxyethyl]-1-benzothiophene (PubChem CID 84589582) has the molecular formula C13H18N2O3S2 and a molecular weight of 314.43 g/mol. Its IUPAC name is 2-[2-[[ethyl(methyl)sulfamoyl]amino]-1-hydroxyethyl]-1-benzothiophene.
| Compound Name | 2-[2-[[ethyl(methyl)sulfamoyl]amino]-1-hydroxyethyl]-1-benzothiophene |
|---|---|
| PubChem CID | 84589582 |
| Molecular Formula | C13H18N2O3S2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 2-[2-[[ethyl(methyl)sulfamoyl]amino]-1-hydroxyethyl]-1-benzothiophene |
| SMILES | CCN(C)S(=O)(=O)NCC(O)c1cc2ccccc2s1 |
| InChI | InChI=1S/C13H18N2O3S2/c1-3-15(2)20(17,18)14-9-11(16)13-8-10-6-4-5-7-12(10)19-13/h4-8,11,14,16H,3,9H2,1-2H3 |
| InChIKey | MUVMPNCZLRCRJJ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |