C15H14N2O2S2 — CID 84590270
1-[2-(benzenesulfonyl)ethyl]-2-thiophen-2-ylimidazole (PubChem CID 84590270) has the molecular formula C15H14N2O2S2 and a molecular weight of 318.42 g/mol. Its IUPAC name is 1-[2-(benzenesulfonyl)ethyl]-2-thiophen-2-ylimidazole.
| Compound Name | 1-[2-(benzenesulfonyl)ethyl]-2-thiophen-2-ylimidazole |
|---|---|
| PubChem CID | 84590270 |
| Molecular Formula | C15H14N2O2S2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 1-[2-(benzenesulfonyl)ethyl]-2-thiophen-2-ylimidazole |
| SMILES | O=S(=O)(CCn1ccnc1-c1cccs1)c1ccccc1 |
| InChI | InChI=1S/C15H14N2O2S2/c18-21(19,13-5-2-1-3-6-13)12-10-17-9-8-16-15(17)14-7-4-11-20-14/h1-9,11H,10,12H2 |
| InChIKey | IFAJBTYAUKTJOU-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |