C16H21N3OS — CID 84593574
1-[(8-methylimidazo[1,2-a]pyridin-3-yl)methyl]-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazine (PubChem CID 84593574) has the molecular formula C16H21N3OS and a molecular weight of 303.43 g/mol. Its IUPAC name is 1-[(8-methylimidazo[1,2-a]pyridin-3-yl)methyl]-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazine.
| Compound Name | 1-[(8-methylimidazo[1,2-a]pyridin-3-yl)methyl]-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazine |
|---|---|
| PubChem CID | 84593574 |
| Molecular Formula | C16H21N3OS |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 1-[(8-methylimidazo[1,2-a]pyridin-3-yl)methyl]-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazine |
| SMILES | Cc1cccn2c(CN3CCSC4COCCC43)cnc12 |
| InChI | InChI=1S/C16H21N3OS/c1-12-3-2-5-19-13(9-17-16(12)19)10-18-6-8-21-15-11-20-7-4-14(15)18/h2-3,5,9,14-15H,4,6-8,10-11H2,1H3 |
| InChIKey | DFSYIMBNOAVPEW-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 29.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |