C18H26N2O2S — CID 84597545
N-methyl-1-[2-(2-phenylpropylsulfanyl)acetyl]piperidine-4-carboxamide (PubChem CID 84597545) has the molecular formula C18H26N2O2S and a molecular weight of 334.48 g/mol. Its IUPAC name is N-methyl-1-[2-(2-phenylpropylsulfanyl)acetyl]piperidine-4-carboxamide.
| Compound Name | N-methyl-1-[2-(2-phenylpropylsulfanyl)acetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 84597545 |
| Molecular Formula | C18H26N2O2S |
| Molecular Weight | 334.48 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | N-methyl-1-[2-(2-phenylpropylsulfanyl)acetyl]piperidine-4-carboxamide |
| SMILES | CNC(=O)C1CCN(C(=O)CSCC(C)c2ccccc2)CC1 |
| InChI | InChI=1S/C18H26N2O2S/c1-14(15-6-4-3-5-7-15)12-23-13-17(21)20-10-8-16(9-11-20)18(22)19-2/h3-7,14,16H,8-13H2,1-2H3,(H,19,22) |
| InChIKey | MVVQFJZXEXUSBW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.48 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |