C14H20BrNO2S — CID 84598699
N-[[1-(2-bromophenyl)cyclopropyl]methyl]-1-methylsulfonylpropan-2-amine (PubChem CID 84598699) has the molecular formula C14H20BrNO2S and a molecular weight of 346.29 g/mol. Its IUPAC name is N-[[1-(2-bromophenyl)cyclopropyl]methyl]-1-methylsulfonylpropan-2-amine.
| Compound Name | N-[[1-(2-bromophenyl)cyclopropyl]methyl]-1-methylsulfonylpropan-2-amine |
|---|---|
| PubChem CID | 84598699 |
| Molecular Formula | C14H20BrNO2S |
| Molecular Weight | 346.29 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | N-[[1-(2-bromophenyl)cyclopropyl]methyl]-1-methylsulfonylpropan-2-amine |
| SMILES | CC(CS(C)(=O)=O)NCC1(c2ccccc2Br)CC1 |
| InChI | InChI=1S/C14H20BrNO2S/c1-11(9-19(2,17)18)16-10-14(7-8-14)12-5-3-4-6-13(12)15/h3-6,11,16H,7-10H2,1-2H3 |
| InChIKey | RQZYWLIPXYQQEA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |