C12H12F2N2 — CID 84598890
2-[[cyclopropyl-(2,5-difluorophenyl)methyl]amino]acetonitrile (PubChem CID 84598890) has the molecular formula C12H12F2N2 and a molecular weight of 222.24 g/mol. Its IUPAC name is 2-[[cyclopropyl-(2,5-difluorophenyl)methyl]amino]acetonitrile.
| Compound Name | 2-[[cyclopropyl-(2,5-difluorophenyl)methyl]amino]acetonitrile |
|---|---|
| PubChem CID | 84598890 |
| Molecular Formula | C12H12F2N2 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 2-[[cyclopropyl-(2,5-difluorophenyl)methyl]amino]acetonitrile |
| SMILES | N#CCNC(c1cc(F)ccc1F)C1CC1 |
| InChI | InChI=1S/C12H12F2N2/c13-9-3-4-11(14)10(7-9)12(8-1-2-8)16-6-5-15/h3-4,7-8,12,16H,1-2,6H2 |
| InChIKey | RMNCPBDEAHRPGP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|