C14H19F2N — CID 83153802
2-cyclopropyl-1-(2,5-difluorophenyl)-N-ethylpropan-1-amine (PubChem CID 83153802) has the molecular formula C14H19F2N and a molecular weight of 239.31 g/mol. Its IUPAC name is 2-cyclopropyl-1-(2,5-difluorophenyl)-N-ethylpropan-1-amine.
| Compound Name | 2-cyclopropyl-1-(2,5-difluorophenyl)-N-ethylpropan-1-amine |
|---|---|
| PubChem CID | 83153802 |
| Molecular Formula | C14H19F2N |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 2-cyclopropyl-1-(2,5-difluorophenyl)-N-ethylpropan-1-amine |
| SMILES | CCNC(c1cc(F)ccc1F)C(C)C1CC1 |
| InChI | InChI=1S/C14H19F2N/c1-3-17-14(9(2)10-4-5-10)12-8-11(15)6-7-13(12)16/h6-10,14,17H,3-5H2,1-2H3 |
| InChIKey | SEEMSDNPCNFCQX-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |