C16H23F2NO3S — CID 84599149
1-(2,4-difluorophenyl)-N-[3-(2-hydroxycyclohexyl)propyl]methanesulfonamide (PubChem CID 84599149) has the molecular formula C16H23F2NO3S and a molecular weight of 347.43 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-N-[3-(2-hydroxycyclohexyl)propyl]methanesulfonamide.
| Compound Name | 1-(2,4-difluorophenyl)-N-[3-(2-hydroxycyclohexyl)propyl]methanesulfonamide |
|---|---|
| PubChem CID | 84599149 |
| Molecular Formula | C16H23F2NO3S |
| Molecular Weight | 347.43 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 1-(2,4-difluorophenyl)-N-[3-(2-hydroxycyclohexyl)propyl]methanesulfonamide |
| SMILES | O=S(=O)(Cc1ccc(F)cc1F)NCCCC1CCCCC1O |
| InChI | InChI=1S/C16H23F2NO3S/c17-14-8-7-13(15(18)10-14)11-23(21,22)19-9-3-5-12-4-1-2-6-16(12)20/h7-8,10,12,16,19-20H,1-6,9,11H2 |
| InChIKey | BMSXQEOMOOJULI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.43 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|