C12H14FN3O3S — CID 84599824
N-(5-tert-butyl-1,2,4-oxadiazol-3-yl)-2-fluorobenzenesulfonamide (PubChem CID 84599824) has the molecular formula C12H14FN3O3S and a molecular weight of 299.33 g/mol. Its IUPAC name is N-(5-tert-butyl-1,2,4-oxadiazol-3-yl)-2-fluorobenzenesulfonamide.
| Compound Name | N-(5-tert-butyl-1,2,4-oxadiazol-3-yl)-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 84599824 |
| Molecular Formula | C12H14FN3O3S |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | N-(5-tert-butyl-1,2,4-oxadiazol-3-yl)-2-fluorobenzenesulfonamide |
| SMILES | CC(C)(C)c1nc(NS(=O)(=O)c2ccccc2F)no1 |
| InChI | InChI=1S/C12H14FN3O3S/c1-12(2,3)10-14-11(15-19-10)16-20(17,18)9-7-5-4-6-8(9)13/h4-7H,1-3H3,(H,15,16) |
| InChIKey | DESNXUFGUXZOQK-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |