C15H25F3N2O3 — CID 84600115
3-(2-hydroxypropyl)-N-[4-(trifluoromethyl)cyclohexyl]morpholine-4-carboxamide (PubChem CID 84600115) has the molecular formula C15H25F3N2O3 and a molecular weight of 338.37 g/mol. Its IUPAC name is 3-(2-hydroxypropyl)-N-[4-(trifluoromethyl)cyclohexyl]morpholine-4-carboxamide.
| Compound Name | 3-(2-hydroxypropyl)-N-[4-(trifluoromethyl)cyclohexyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 84600115 |
| Molecular Formula | C15H25F3N2O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | 3-(2-hydroxypropyl)-N-[4-(trifluoromethyl)cyclohexyl]morpholine-4-carboxamide |
| SMILES | CC(O)CC1COCCN1C(=O)NC1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H25F3N2O3/c1-10(21)8-13-9-23-7-6-20(13)14(22)19-12-4-2-11(3-5-12)15(16,17)18/h10-13,21H,2-9H2,1H3,(H,19,22) |
| InChIKey | WAHMZKDKUXCPMP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |