C14H13Cl2NO3 — CID 84601511
2-(2,5-dichlorophenoxy)-N-(furan-2-ylmethyl)-N-methylacetamide (PubChem CID 84601511) has the molecular formula C14H13Cl2NO3 and a molecular weight of 314.17 g/mol. Its IUPAC name is 2-(2,5-dichlorophenoxy)-N-(furan-2-ylmethyl)-N-methylacetamide.
| Compound Name | 2-(2,5-dichlorophenoxy)-N-(furan-2-ylmethyl)-N-methylacetamide |
|---|---|
| PubChem CID | 84601511 |
| Molecular Formula | C14H13Cl2NO3 |
| Molecular Weight | 314.17 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | 2-(2,5-dichlorophenoxy)-N-(furan-2-ylmethyl)-N-methylacetamide |
| SMILES | CN(Cc1ccco1)C(=O)COc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H13Cl2NO3/c1-17(8-11-3-2-6-19-11)14(18)9-20-13-7-10(15)4-5-12(13)16/h2-7H,8-9H2,1H3 |
| InChIKey | PADCVEGGHLHSDS-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.17 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |