C16H18ClNO3 — CID 78768448
2-(4-chloro-2-methylphenoxy)-N-methyl-N-[(5-methylfuran-2-yl)methyl]acetamide (PubChem CID 78768448) has the molecular formula C16H18ClNO3 and a molecular weight of 307.78 g/mol. Its IUPAC name is 2-(4-chloro-2-methylphenoxy)-N-methyl-N-[(5-methylfuran-2-yl)methyl]acetamide.
| Compound Name | 2-(4-chloro-2-methylphenoxy)-N-methyl-N-[(5-methylfuran-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 78768448 |
| Molecular Formula | C16H18ClNO3 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 2-(4-chloro-2-methylphenoxy)-N-methyl-N-[(5-methylfuran-2-yl)methyl]acetamide |
| SMILES | Cc1ccc(CN(C)C(=O)COc2ccc(Cl)cc2C)o1 |
| InChI | InChI=1S/C16H18ClNO3/c1-11-8-13(17)5-7-15(11)20-10-16(19)18(3)9-14-6-4-12(2)21-14/h4-8H,9-10H2,1-3H3 |
| InChIKey | UDYBLWSRECIARE-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |