C21H25ClN2O3 — CID 17465759
2-(4-chloro-2-methylphenoxy)-N-methyl-N-[(2-morpholin-4-ylphenyl)methyl]acetamide (PubChem CID 17465759) has the molecular formula C21H25ClN2O3 and a molecular weight of 388.90 g/mol. Its IUPAC name is 2-(4-chloro-2-methylphenoxy)-N-methyl-N-[(2-morpholin-4-ylphenyl)methyl]acetamide.
| Compound Name | 2-(4-chloro-2-methylphenoxy)-N-methyl-N-[(2-morpholin-4-ylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 17465759 |
| Molecular Formula | C21H25ClN2O3 |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 2-(4-chloro-2-methylphenoxy)-N-methyl-N-[(2-morpholin-4-ylphenyl)methyl]acetamide |
| SMILES | Cc1cc(Cl)ccc1OCC(=O)N(C)Cc1ccccc1N1CCOCC1 |
| InChI | InChI=1S/C21H25ClN2O3/c1-16-13-18(22)7-8-20(16)27-15-21(25)23(2)14-17-5-3-4-6-19(17)24-9-11-26-12-10-24/h3-8,13H,9-12,14-15H2,1-2H3 |
| InChIKey | MDHHGQGWEZBDSD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |