C13H12BrNO2S — CID 84606686
4-[5-(3-bromophenyl)-1,3-thiazol-4-yl]butanoic acid (PubChem CID 84606686) has the molecular formula C13H12BrNO2S and a molecular weight of 326.22 g/mol. Its IUPAC name is 4-[5-(3-bromophenyl)-1,3-thiazol-4-yl]butanoic acid.
| Compound Name | 4-[5-(3-bromophenyl)-1,3-thiazol-4-yl]butanoic acid |
|---|---|
| PubChem CID | 84606686 |
| Molecular Formula | C13H12BrNO2S |
| Molecular Weight | 326.22 g/mol |
| Exact Mass | 324.98 |
| IUPAC Name | 4-[5-(3-bromophenyl)-1,3-thiazol-4-yl]butanoic acid |
| SMILES | O=C(O)CCCc1ncsc1-c1cccc(Br)c1 |
| InChI | InChI=1S/C13H12BrNO2S/c14-10-4-1-3-9(7-10)13-11(15-8-18-13)5-2-6-12(16)17/h1,3-4,7-8H,2,5-6H2,(H,16,17) |
| InChIKey | AZOBQOYMQRYEHD-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.22 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |