4-(4-phenylthiophen-2-yl)butanoic acid

C14H14O2S — CID 165409992

IUPAC4-(4-phenylthiophen-2-yl)butanoic acid
SMILESO=C(O)CCCc1cc(-c2ccccc2)cs1
InChIInChI=1S/C14H14O2S/c15-14(16)8-4-7-13-9-12(10-17-13)11-5-2-1-3-6-11/h1-3,5-6,9-10H,4,7-8H2,(H,15,16)
InChIKeyDLJAACUFOFYPOZ-UHFFFAOYSA-N
MW246.33 g/mol
LogP3.82
Rot. Bonds5

About 4-(4-phenylthiophen-2-yl)butanoic acid

4-(4-phenylthiophen-2-yl)butanoic acid (PubChem CID 165409992) has the molecular formula C14H14O2S and a molecular weight of 246.33 g/mol. Its IUPAC name is 4-(4-phenylthiophen-2-yl)butanoic acid.

Molecular Properties

Compound Name4-(4-phenylthiophen-2-yl)butanoic acid
PubChem CID165409992
Molecular FormulaC14H14O2S
Molecular Weight246.33 g/mol
Exact Mass246.07
IUPAC Name4-(4-phenylthiophen-2-yl)butanoic acid
SMILESO=C(O)CCCc1cc(-c2ccccc2)cs1
InChIInChI=1S/C14H14O2S/c15-14(16)8-4-7-13-9-12(10-17-13)11-5-2-1-3-6-11/h1-3,5-6,9-10H,4,7-8H2,(H,15,16)
InChIKeyDLJAACUFOFYPOZ-UHFFFAOYSA-N
XLogP3.82
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.33
LogP ≤ 53.82
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 4-(4-phenylthiophen-2-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

1,1'-biphenyl;decanedioic acid;hydrazine
CID 159076350
2-[(4-phenylthiophen-2-yl)methylamino]propanoic acid
CID 54960058
4-(5-phenyl-1,3,4-oxadiazol-2-yl)butanoic acid
CID 23986643
4-(3-phenyl-1,2-oxazol-5-yl)butanoic acid
CID 102036434
3-[(4-phenylthiophen-2-yl)methylamino]propan-1-ol
CID 54904244
3-[4-[5-[[methyl(octanoyl)amino]methyl]thiophen-3-yl]phenyl]propanoic acid
CID 11553138
ethyl 2-[(4-phenylthiophen-2-yl)methylamino]acetate
CID 54903997
methyl 2-[(4-phenylthiophen-2-yl)methylamino]propanoate
CID 61018262
N-ethyl-2-[(4-phenylthiophen-2-yl)methylamino]acetamide
CID 54903925
4-thiophen-2-ylbutanoic acid;2,2,2-trifluoroacetic acid
CID 174398681
pentanedioic acid;toluene
CID 159822689
4-(5-thiophen-2-ylthiophen-2-yl)butanoic acid
CID 70912798

Frequently Asked Questions

What is the IUPAC name of 4-(4-phenylthiophen-2-yl)butanoic acid?
The IUPAC name of 4-(4-phenylthiophen-2-yl)butanoic acid (CID 165409992) is 4-(4-phenylthiophen-2-yl)butanoic acid.
What is the SMILES notation for 4-(4-phenylthiophen-2-yl)butanoic acid?
The canonical SMILES for 4-(4-phenylthiophen-2-yl)butanoic acid is O=C(O)CCCc1cc(-c2ccccc2)cs1.
What is the InChIKey of 4-(4-phenylthiophen-2-yl)butanoic acid?
The InChIKey is DLJAACUFOFYPOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O2S/c15-14(16)8-4-7-13-9-12(10-17-13)11-5-2-1-3-6-11/h1-3,5-6,9-10H,4,7-8H2,(H,15,16).
What are the key properties of 4-(4-phenylthiophen-2-yl)butanoic acid?
4-(4-phenylthiophen-2-yl)butanoic acid has a molecular weight of 246.33 g/mol, XLogP of 3.82, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-phenylthiophen-2-yl)butanoic acid is sourced from PubChem (CID 165409992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).