C14H20BrN3O — CID 84606919
3-(2-aminoethyl)-4-(4-bromo-2-methylphenyl)-1-methylpiperazin-2-one (PubChem CID 84606919) has the molecular formula C14H20BrN3O and a molecular weight of 326.24 g/mol. Its IUPAC name is 3-(2-aminoethyl)-4-(4-bromo-2-methylphenyl)-1-methylpiperazin-2-one.
| Compound Name | 3-(2-aminoethyl)-4-(4-bromo-2-methylphenyl)-1-methylpiperazin-2-one |
|---|---|
| PubChem CID | 84606919 |
| Molecular Formula | C14H20BrN3O |
| Molecular Weight | 326.24 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 3-(2-aminoethyl)-4-(4-bromo-2-methylphenyl)-1-methylpiperazin-2-one |
| SMILES | Cc1cc(Br)ccc1N1CCN(C)C(=O)C1CCN |
| InChI | InChI=1S/C14H20BrN3O/c1-10-9-11(15)3-4-12(10)18-8-7-17(2)14(19)13(18)5-6-16/h3-4,9,13H,5-8,16H2,1-2H3 |
| InChIKey | XGSGFDIMZVYUKE-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.24 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |