C11H13BrClN3S — CID 84610127
2-[5-bromo-4-(5-chlorothiophen-2-yl)-1-methylimidazol-2-yl]-N-methylethanamine (PubChem CID 84610127) has the molecular formula C11H13BrClN3S and a molecular weight of 334.67 g/mol. Its IUPAC name is 2-[5-bromo-4-(5-chlorothiophen-2-yl)-1-methylimidazol-2-yl]-N-methylethanamine.
| Compound Name | 2-[5-bromo-4-(5-chlorothiophen-2-yl)-1-methylimidazol-2-yl]-N-methylethanamine |
|---|---|
| PubChem CID | 84610127 |
| Molecular Formula | C11H13BrClN3S |
| Molecular Weight | 334.67 g/mol |
| Exact Mass | 332.97 |
| IUPAC Name | 2-[5-bromo-4-(5-chlorothiophen-2-yl)-1-methylimidazol-2-yl]-N-methylethanamine |
| SMILES | CNCCc1nc(-c2ccc(Cl)s2)c(Br)n1C |
| InChI | InChI=1S/C11H13BrClN3S/c1-14-6-5-9-15-10(11(12)16(9)2)7-3-4-8(13)17-7/h3-4,14H,5-6H2,1-2H3 |
| InChIKey | DZXRSVVSDCMSRD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.67 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |