C10H11BrN2O4S — CID 84610228
2-(2-bromophenyl)-1,1-dioxo-1,2,6-thiadiazinane-4-carboxylic acid (PubChem CID 84610228) has the molecular formula C10H11BrN2O4S and a molecular weight of 335.18 g/mol. Its IUPAC name is 2-(2-bromophenyl)-1,1-dioxo-1,2,6-thiadiazinane-4-carboxylic acid.
| Compound Name | 2-(2-bromophenyl)-1,1-dioxo-1,2,6-thiadiazinane-4-carboxylic acid |
|---|---|
| PubChem CID | 84610228 |
| Molecular Formula | C10H11BrN2O4S |
| Molecular Weight | 335.18 g/mol |
| Exact Mass | 333.96 |
| IUPAC Name | 2-(2-bromophenyl)-1,1-dioxo-1,2,6-thiadiazinane-4-carboxylic acid |
| SMILES | O=C(O)C1CNS(=O)(=O)N(c2ccccc2Br)C1 |
| InChI | InChI=1S/C10H11BrN2O4S/c11-8-3-1-2-4-9(8)13-6-7(10(14)15)5-12-18(13,16)17/h1-4,7,12H,5-6H2,(H,14,15) |
| InChIKey | JCSCCNXTJOMXSY-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.18 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |