C13H15BrO2 — CID 115052012
3-(2-bromophenyl)cyclohexane-1-carboxylic acid (PubChem CID 115052012) has the molecular formula C13H15BrO2 and a molecular weight of 283.16 g/mol. Its IUPAC name is 3-(2-bromophenyl)cyclohexane-1-carboxylic acid.
| Compound Name | 3-(2-bromophenyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 115052012 |
| Molecular Formula | C13H15BrO2 |
| Molecular Weight | 283.16 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 3-(2-bromophenyl)cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCCC(c2ccccc2Br)C1 |
| InChI | InChI=1S/C13H15BrO2/c14-12-7-2-1-6-11(12)9-4-3-5-10(8-9)13(15)16/h1-2,6-7,9-10H,3-5,8H2,(H,15,16) |
| InChIKey | HMBZXIFXJWGSET-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.16 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |