C14H17ClO — CID 164769658
2-chloro-1-[(1S,3R)-3-phenylcyclohexyl]ethanone (PubChem CID 164769658) has the molecular formula C14H17ClO and a molecular weight of 236.74 g/mol. Its IUPAC name is 2-chloro-1-[(1S,3R)-3-phenylcyclohexyl]ethanone.
| Compound Name | 2-chloro-1-[(1S,3R)-3-phenylcyclohexyl]ethanone |
|---|---|
| PubChem CID | 164769658 |
| Molecular Formula | C14H17ClO |
| Molecular Weight | 236.74 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 2-chloro-1-[(1S,3R)-3-phenylcyclohexyl]ethanone |
| SMILES | O=C(CCl)[C@H]1CCC[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C14H17ClO/c15-10-14(16)13-8-4-7-12(9-13)11-5-2-1-3-6-11/h1-3,5-6,12-13H,4,7-10H2/t12-,13+/m1/s1 |
| InChIKey | AYRSXFAUYWDNML-OLZOCXBDSA-N |
| XLogP | 3.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.74 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|