C15H15BrO2S — CID 84612021
2-[4-[(4-bromothiophen-2-yl)methyl]phenyl]-2-methylpropanoic acid (PubChem CID 84612021) has the molecular formula C15H15BrO2S and a molecular weight of 339.25 g/mol. Its IUPAC name is 2-[4-[(4-bromothiophen-2-yl)methyl]phenyl]-2-methylpropanoic acid.
| Compound Name | 2-[4-[(4-bromothiophen-2-yl)methyl]phenyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 84612021 |
| Molecular Formula | C15H15BrO2S |
| Molecular Weight | 339.25 g/mol |
| Exact Mass | 338.00 |
| IUPAC Name | 2-[4-[(4-bromothiophen-2-yl)methyl]phenyl]-2-methylpropanoic acid |
| SMILES | CC(C)(C(=O)O)c1ccc(Cc2cc(Br)cs2)cc1 |
| InChI | InChI=1S/C15H15BrO2S/c1-15(2,14(17)18)11-5-3-10(4-6-11)7-13-8-12(16)9-19-13/h3-6,8-9H,7H2,1-2H3,(H,17,18) |
| InChIKey | KHUWHQLDWUOHQK-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.25 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |