C11H14N4OS — CID 84613480
2-(5-cyano-2,4-dimethyl-6-methylsulfanyl-3-pyridinyl)acetohydrazide (PubChem CID 84613480) has the molecular formula C11H14N4OS and a molecular weight of 250.33 g/mol. Its IUPAC name is 2-(5-cyano-2,4-dimethyl-6-methylsulfanyl-3-pyridinyl)acetohydrazide.
| Compound Name | 2-(5-cyano-2,4-dimethyl-6-methylsulfanyl-3-pyridinyl)acetohydrazide |
|---|---|
| PubChem CID | 84613480 |
| Molecular Formula | C11H14N4OS |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 2-(5-cyano-2,4-dimethyl-6-methylsulfanyl-3-pyridinyl)acetohydrazide |
| SMILES | CSc1nc(C)c(CC(=O)NN)c(C)c1C#N |
| InChI | InChI=1S/C11H14N4OS/c1-6-8(4-10(16)15-13)7(2)14-11(17-3)9(6)5-12/h4,13H2,1-3H3,(H,15,16) |
| InChIKey | SKDIAIYQKDALBS-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|