C12H14N2O3S — CID 84615540
3-(7-amino-2-methyl-3-oxo-1,4-benzothiazin-4-yl)propanoic acid (PubChem CID 84615540) has the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. Its IUPAC name is 3-(7-amino-2-methyl-3-oxo-1,4-benzothiazin-4-yl)propanoic acid.
| Compound Name | 3-(7-amino-2-methyl-3-oxo-1,4-benzothiazin-4-yl)propanoic acid |
|---|---|
| PubChem CID | 84615540 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 3-(7-amino-2-methyl-3-oxo-1,4-benzothiazin-4-yl)propanoic acid |
| SMILES | CC1Sc2cc(N)ccc2N(CCC(=O)O)C1=O |
| InChI | InChI=1S/C12H14N2O3S/c1-7-12(17)14(5-4-11(15)16)9-3-2-8(13)6-10(9)18-7/h2-3,6-7H,4-5,13H2,1H3,(H,15,16) |
| InChIKey | IJMIWBLHYPZNDJ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|