C13H17NO4 — CID 84618104
2-(2-hydroxy-4-piperidin-4-yloxyphenyl)acetic acid (PubChem CID 84618104) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is 2-(2-hydroxy-4-piperidin-4-yloxyphenyl)acetic acid.
| Compound Name | 2-(2-hydroxy-4-piperidin-4-yloxyphenyl)acetic acid |
|---|---|
| PubChem CID | 84618104 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 2-(2-hydroxy-4-piperidin-4-yloxyphenyl)acetic acid |
| SMILES | O=C(O)Cc1ccc(OC2CCNCC2)cc1O |
| InChI | InChI=1S/C13H17NO4/c15-12-8-11(2-1-9(12)7-13(16)17)18-10-3-5-14-6-4-10/h1-2,8,10,14-15H,3-7H2,(H,16,17) |
| InChIKey | LZLHIXQKNBRREC-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |