C20H18F3NO4 — CID 67164914
2-piperidin-4-yloxyfluoren-9-one;2,2,2-trifluoroacetic acid (PubChem CID 67164914) has the molecular formula C20H18F3NO4 and a molecular weight of 393.36 g/mol. Its IUPAC name is 2-piperidin-4-yloxyfluoren-9-one;2,2,2-trifluoroacetic acid.
| Compound Name | 2-piperidin-4-yloxyfluoren-9-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67164914 |
| Molecular Formula | C20H18F3NO4 |
| Molecular Weight | 393.36 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 2-piperidin-4-yloxyfluoren-9-one;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C1c2ccccc2-c2ccc(OC3CCNCC3)cc21 |
| InChI | InChI=1S/C18H17NO2.C2HF3O2/c20-18-16-4-2-1-3-14(16)15-6-5-13(11-17(15)18)21-12-7-9-19-10-8-12;3-2(4,5)1(6)7/h1-6,11-12,19H,7-10H2;(H,6,7) |
| InChIKey | QPZPINNONJMCKR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.36 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |