C10H15N3O — CID 84619169
2-(aminomethyl)-3-methyl-3,4-dihydro-2H-1,4-benzoxazin-6-amine (PubChem CID 84619169) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is 2-(aminomethyl)-3-methyl-3,4-dihydro-2H-1,4-benzoxazin-6-amine.
| Compound Name | 2-(aminomethyl)-3-methyl-3,4-dihydro-2H-1,4-benzoxazin-6-amine |
|---|---|
| PubChem CID | 84619169 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 2-(aminomethyl)-3-methyl-3,4-dihydro-2H-1,4-benzoxazin-6-amine |
| SMILES | CC1Nc2cc(N)ccc2OC1CN |
| InChI | InChI=1S/C10H15N3O/c1-6-10(5-11)14-9-3-2-7(12)4-8(9)13-6/h2-4,6,10,13H,5,11-12H2,1H3 |
| InChIKey | VSNJUTGAMSDNBL-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|