C12H14N2O — CID 84619894
3-(2-aminoethyl)-5-methyl-2H-isoquinolin-1-one (PubChem CID 84619894) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 3-(2-aminoethyl)-5-methyl-2H-isoquinolin-1-one.
| Compound Name | 3-(2-aminoethyl)-5-methyl-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 84619894 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 3-(2-aminoethyl)-5-methyl-2H-isoquinolin-1-one |
| SMILES | Cc1cccc2c(=O)[nH]c(CCN)cc12 |
| InChI | InChI=1S/C12H14N2O/c1-8-3-2-4-10-11(8)7-9(5-6-13)14-12(10)15/h2-4,7H,5-6,13H2,1H3,(H,14,15) |
| InChIKey | BOTJWNMLNCGNGF-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |