C18H24N2O2 — CID 10357458
3-[2-[2-(hydroxymethyl)piperidin-1-yl]ethyl]-5-methyl-2H-isoquinolin-1-one (PubChem CID 10357458) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is 3-[2-[2-(hydroxymethyl)piperidin-1-yl]ethyl]-5-methyl-2H-isoquinolin-1-one.
| Compound Name | 3-[2-[2-(hydroxymethyl)piperidin-1-yl]ethyl]-5-methyl-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 10357458 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 3-[2-[2-(hydroxymethyl)piperidin-1-yl]ethyl]-5-methyl-2H-isoquinolin-1-one |
| SMILES | Cc1cccc2c(=O)[nH]c(CCN3CCCCC3CO)cc12 |
| InChI | InChI=1S/C18H24N2O2/c1-13-5-4-7-16-17(13)11-14(19-18(16)22)8-10-20-9-3-2-6-15(20)12-21/h4-5,7,11,15,21H,2-3,6,8-10,12H2,1H3,(H,19,22) |
| InChIKey | WGMHTWZGWRXPBC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |