C15H20N2 — CID 84625661
3,6-dimethyl-2-piperidin-4-yl-1H-indole (PubChem CID 84625661) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 3,6-dimethyl-2-piperidin-4-yl-1H-indole.
| Compound Name | 3,6-dimethyl-2-piperidin-4-yl-1H-indole |
|---|---|
| PubChem CID | 84625661 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 3,6-dimethyl-2-piperidin-4-yl-1H-indole |
| SMILES | Cc1ccc2c(C)c(C3CCNCC3)[nH]c2c1 |
| InChI | InChI=1S/C15H20N2/c1-10-3-4-13-11(2)15(17-14(13)9-10)12-5-7-16-8-6-12/h3-4,9,12,16-17H,5-8H2,1-2H3 |
| InChIKey | YJFCHGIFWDTCAO-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |