C15H26N2 — CID 166120568
N,5-dimethyl-2-piperidin-4-ylaniline;ethane (PubChem CID 166120568) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is N,5-dimethyl-2-piperidin-4-ylaniline;ethane.
| Compound Name | N,5-dimethyl-2-piperidin-4-ylaniline;ethane |
|---|---|
| PubChem CID | 166120568 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | N,5-dimethyl-2-piperidin-4-ylaniline;ethane |
| SMILES | CC.CNc1cc(C)ccc1C1CCNCC1 |
| InChI | InChI=1S/C13H20N2.C2H6/c1-10-3-4-12(13(9-10)14-2)11-5-7-15-8-6-11;1-2/h3-4,9,11,14-15H,5-8H2,1-2H3;1-2H3 |
| InChIKey | LRRVTDRUILTBSE-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |