C18H30N2O — CID 155709393
N,N-dimethyl-2-(5-methyl-2-piperidin-4-ylphenyl)acetamide;ethane (PubChem CID 155709393) has the molecular formula C18H30N2O and a molecular weight of 290.45 g/mol. Its IUPAC name is N,N-dimethyl-2-(5-methyl-2-piperidin-4-ylphenyl)acetamide;ethane.
| Compound Name | N,N-dimethyl-2-(5-methyl-2-piperidin-4-ylphenyl)acetamide;ethane |
|---|---|
| PubChem CID | 155709393 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | N,N-dimethyl-2-(5-methyl-2-piperidin-4-ylphenyl)acetamide;ethane |
| SMILES | CC.Cc1ccc(C2CCNCC2)c(CC(=O)N(C)C)c1 |
| InChI | InChI=1S/C16H24N2O.C2H6/c1-12-4-5-15(13-6-8-17-9-7-13)14(10-12)11-16(19)18(2)3;1-2/h4-5,10,13,17H,6-9,11H2,1-3H3;1-2H3 |
| InChIKey | RBWWHCPSJDCKQI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |