C15H22N2O — CID 177301315
3-methyl-4-piperidin-4-yl-N,N-bis(trideuteriomethyl)benzamide (PubChem CID 177301315) has the molecular formula C15H22N2O and a molecular weight of 252.39 g/mol. Its IUPAC name is 3-methyl-4-piperidin-4-yl-N,N-bis(trideuteriomethyl)benzamide.
| Compound Name | 3-methyl-4-piperidin-4-yl-N,N-bis(trideuteriomethyl)benzamide |
|---|---|
| PubChem CID | 177301315 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 252.39 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | 3-methyl-4-piperidin-4-yl-N,N-bis(trideuteriomethyl)benzamide |
| SMILES | [2H]C([2H])([2H])N(C(=O)c1ccc(C2CCNCC2)c(C)c1)C([2H])([2H])[2H] |
| InChI | InChI=1S/C15H22N2O/c1-11-10-13(15(18)17(2)3)4-5-14(11)12-6-8-16-9-7-12/h4-5,10,12,16H,6-9H2,1-3H3/i2D3,3D3 |
| InChIKey | XFWBOGTZEHHQPN-XERRXZQWSA-N |
| XLogP | 2.16 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.39 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |