C10H13NO — CID 167709287
3-methyl-N,N-bis(trideuteriomethyl)benzamide (PubChem CID 167709287) has the molecular formula C10H13NO and a molecular weight of 169.26 g/mol. Its IUPAC name is 3-methyl-N,N-bis(trideuteriomethyl)benzamide.
| Compound Name | 3-methyl-N,N-bis(trideuteriomethyl)benzamide |
|---|---|
| PubChem CID | 167709287 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 169.26 g/mol |
| Exact Mass | 169.14 |
| IUPAC Name | 3-methyl-N,N-bis(trideuteriomethyl)benzamide |
| SMILES | [2H]C([2H])([2H])N(C(=O)c1cccc(C)c1)C([2H])([2H])[2H] |
| InChI | InChI=1S/C10H13NO/c1-8-5-4-6-9(7-8)10(12)11(2)3/h4-7H,1-3H3/i2D3,3D3 |
| InChIKey | SWYVHBPXKKDGLL-XERRXZQWSA-N |
| XLogP | 1.70 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |