C13H13ClO2 — CID 84628624
(2E)-2-(5-chloro-3-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)acetic acid (PubChem CID 84628624) has the molecular formula C13H13ClO2 and a molecular weight of 236.70 g/mol. Its IUPAC name is (2E)-2-(5-chloro-3-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)acetic acid.
| Compound Name | (2E)-2-(5-chloro-3-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)acetic acid |
|---|---|
| PubChem CID | 84628624 |
| Molecular Formula | C13H13ClO2 |
| Molecular Weight | 236.70 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | (2E)-2-(5-chloro-3-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)acetic acid |
| SMILES | CC1C/C(=C\C(=O)O)c2cccc(Cl)c2C1 |
| InChI | InChI=1S/C13H13ClO2/c1-8-5-9(7-13(15)16)10-3-2-4-12(14)11(10)6-8/h2-4,7-8H,5-6H2,1H3,(H,15,16)/b9-7+ |
| InChIKey | HTPDOEWMLQESMX-VQHVLOKHSA-N |
| XLogP | 3.39 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.70 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|