C15H18N2O — CID 84630283
1,8-dimethyl-3-pyrrolidin-3-ylquinolin-2-one (PubChem CID 84630283) has the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. Its IUPAC name is 1,8-dimethyl-3-pyrrolidin-3-ylquinolin-2-one.
| Compound Name | 1,8-dimethyl-3-pyrrolidin-3-ylquinolin-2-one |
|---|---|
| PubChem CID | 84630283 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 1,8-dimethyl-3-pyrrolidin-3-ylquinolin-2-one |
| SMILES | Cc1cccc2cc(C3CCNC3)c(=O)n(C)c12 |
| InChI | InChI=1S/C15H18N2O/c1-10-4-3-5-11-8-13(12-6-7-16-9-12)15(18)17(2)14(10)11/h3-5,8,12,16H,6-7,9H2,1-2H3 |
| InChIKey | RQCKAMRACCLXPL-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |