C16H20N2O — CID 84636026
1,7,8-trimethyl-3-pyrrolidin-3-ylquinolin-2-one (PubChem CID 84636026) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is 1,7,8-trimethyl-3-pyrrolidin-3-ylquinolin-2-one.
| Compound Name | 1,7,8-trimethyl-3-pyrrolidin-3-ylquinolin-2-one |
|---|---|
| PubChem CID | 84636026 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 1,7,8-trimethyl-3-pyrrolidin-3-ylquinolin-2-one |
| SMILES | Cc1ccc2cc(C3CCNC3)c(=O)n(C)c2c1C |
| InChI | InChI=1S/C16H20N2O/c1-10-4-5-12-8-14(13-6-7-17-9-13)16(19)18(3)15(12)11(10)2/h4-5,8,13,17H,6-7,9H2,1-3H3 |
| InChIKey | DHYJVXKOTFAVQH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |