C11H11F3N2O — CID 84631097
1-ethyl-7-(trifluoromethyl)-3,4-dihydroquinoxalin-2-one (PubChem CID 84631097) has the molecular formula C11H11F3N2O and a molecular weight of 244.22 g/mol. Its IUPAC name is 1-ethyl-7-(trifluoromethyl)-3,4-dihydroquinoxalin-2-one.
| Compound Name | 1-ethyl-7-(trifluoromethyl)-3,4-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 84631097 |
| Molecular Formula | C11H11F3N2O |
| Molecular Weight | 244.22 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 1-ethyl-7-(trifluoromethyl)-3,4-dihydroquinoxalin-2-one |
| SMILES | CCN1C(=O)CNc2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C11H11F3N2O/c1-2-16-9-5-7(11(12,13)14)3-4-8(9)15-6-10(16)17/h3-5,15H,2,6H2,1H3 |
| InChIKey | AJHGGXVMKYCVHQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.22 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |