About 8-fluoro-1,4-dimethyl-3-[2-(methylamino)ethyl]quinolin-2-one
8-fluoro-1,4-dimethyl-3-[2-(methylamino)ethyl]quinolin-2-one (PubChem CID 84633123) has the molecular formula C14H17FN2O
and a molecular weight of 248.30 g/mol. Its IUPAC name is 8-fluoro-1,4-dimethyl-3-[2-(methylamino)ethyl]quinolin-2-one.
Molecular Properties
| Compound Name | 8-fluoro-1,4-dimethyl-3-[2-(methylamino)ethyl]quinolin-2-one |
| PubChem CID | 84633123 |
| Molecular Formula | C14H17FN2O |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 8-fluoro-1,4-dimethyl-3-[2-(methylamino)ethyl]quinolin-2-one |
| SMILES | CNCCc1c(C)c2cccc(F)c2n(C)c1=O |
| InChI | InChI=1S/C14H17FN2O/c1-9-10-5-4-6-12(15)13(10)17(3)14(18)11(9)7-8-16-2/h4-6,16H,7-8H2,1-3H3 |
| InChIKey | KIECKANUNZHIQP-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-fluoro-1,4-dimethyl-3-[2-(methylamino)ethyl]quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-1,4-dimethyl-3-[2-(methylamino)ethyl]quinolin-2-one?
The IUPAC name of 8-fluoro-1,4-dimethyl-3-[2-(methylamino)ethyl]quinolin-2-one (CID 84633123) is 8-fluoro-1,4-dimethyl-3-[2-(methylamino)ethyl]quinolin-2-one.
What is the SMILES notation for 8-fluoro-1,4-dimethyl-3-[2-(methylamino)ethyl]quinolin-2-one?
The canonical SMILES for 8-fluoro-1,4-dimethyl-3-[2-(methylamino)ethyl]quinolin-2-one is CNCCc1c(C)c2cccc(F)c2n(C)c1=O.
What is the InChIKey of 8-fluoro-1,4-dimethyl-3-[2-(methylamino)ethyl]quinolin-2-one?
The InChIKey is KIECKANUNZHIQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17FN2O/c1-9-10-5-4-6-12(15)13(10)17(3)14(18)11(9)7-8-16-2/h4-6,16H,7-8H2,1-3H3.
What are the key properties of 8-fluoro-1,4-dimethyl-3-[2-(methylamino)ethyl]quinolin-2-one?
8-fluoro-1,4-dimethyl-3-[2-(methylamino)ethyl]quinolin-2-one has a molecular weight of 248.30 g/mol, XLogP of 1.75, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-1,4-dimethyl-3-[2-(methylamino)ethyl]quinolin-2-one is sourced from PubChem (CID 84633123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).