C14H15N5 — CID 84634913
7-methyl-2-(methylaminomethyl)pyrimido[4,5-b]quinolin-4-amine (PubChem CID 84634913) has the molecular formula C14H15N5 and a molecular weight of 253.31 g/mol. Its IUPAC name is 7-methyl-2-(methylaminomethyl)pyrimido[4,5-b]quinolin-4-amine.
| Compound Name | 7-methyl-2-(methylaminomethyl)pyrimido[4,5-b]quinolin-4-amine |
|---|---|
| PubChem CID | 84634913 |
| Molecular Formula | C14H15N5 |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 7-methyl-2-(methylaminomethyl)pyrimido[4,5-b]quinolin-4-amine |
| SMILES | CNCc1nc(N)c2cc3cc(C)ccc3nc2n1 |
| InChI | InChI=1S/C14H15N5/c1-8-3-4-11-9(5-8)6-10-13(15)18-12(7-16-2)19-14(10)17-11/h3-6,16H,7H2,1-2H3,(H2,15,17,18,19) |
| InChIKey | MWILXRCXEZUDEU-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|