C17H22N2 — CID 84635397
5,7-dimethyl-3-(piperidin-3-ylmethyl)quinoline (PubChem CID 84635397) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is 5,7-dimethyl-3-(piperidin-3-ylmethyl)quinoline.
| Compound Name | 5,7-dimethyl-3-(piperidin-3-ylmethyl)quinoline |
|---|---|
| PubChem CID | 84635397 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 5,7-dimethyl-3-(piperidin-3-ylmethyl)quinoline |
| SMILES | Cc1cc(C)c2cc(CC3CCCNC3)cnc2c1 |
| InChI | InChI=1S/C17H22N2/c1-12-6-13(2)16-9-15(11-19-17(16)7-12)8-14-4-3-5-18-10-14/h6-7,9,11,14,18H,3-5,8,10H2,1-2H3 |
| InChIKey | XWEYLBDGJNNMGI-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |