C15H21N3O — CID 84637866
6-methoxy-2-methyl-3-(1-methylpiperazin-2-yl)-1H-indole (PubChem CID 84637866) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is 6-methoxy-2-methyl-3-(1-methylpiperazin-2-yl)-1H-indole.
| Compound Name | 6-methoxy-2-methyl-3-(1-methylpiperazin-2-yl)-1H-indole |
|---|---|
| PubChem CID | 84637866 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 6-methoxy-2-methyl-3-(1-methylpiperazin-2-yl)-1H-indole |
| SMILES | COc1ccc2c(C3CNCCN3C)c(C)[nH]c2c1 |
| InChI | InChI=1S/C15H21N3O/c1-10-15(14-9-16-6-7-18(14)2)12-5-4-11(19-3)8-13(12)17-10/h4-5,8,14,16-17H,6-7,9H2,1-3H3 |
| InChIKey | NWOFARIMPUEFPT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 40.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|