C11H10BrN3 — CID 84639418
2-(7-bromo-1,5-dimethylbenzimidazol-2-yl)acetonitrile (PubChem CID 84639418) has the molecular formula C11H10BrN3 and a molecular weight of 264.13 g/mol. Its IUPAC name is 2-(7-bromo-1,5-dimethylbenzimidazol-2-yl)acetonitrile.
| Compound Name | 2-(7-bromo-1,5-dimethylbenzimidazol-2-yl)acetonitrile |
|---|---|
| PubChem CID | 84639418 |
| Molecular Formula | C11H10BrN3 |
| Molecular Weight | 264.13 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | 2-(7-bromo-1,5-dimethylbenzimidazol-2-yl)acetonitrile |
| SMILES | Cc1cc(Br)c2c(c1)nc(CC#N)n2C |
| InChI | InChI=1S/C11H10BrN3/c1-7-5-8(12)11-9(6-7)14-10(3-4-13)15(11)2/h5-6H,3H2,1-2H3 |
| InChIKey | FXNIJAZUUPOBFE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.13 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |