C12H13N3 — CID 84619631
2-(1,5,7-trimethylbenzimidazol-2-yl)acetonitrile (PubChem CID 84619631) has the molecular formula C12H13N3 and a molecular weight of 199.26 g/mol. Its IUPAC name is 2-(1,5,7-trimethylbenzimidazol-2-yl)acetonitrile.
| Compound Name | 2-(1,5,7-trimethylbenzimidazol-2-yl)acetonitrile |
|---|---|
| PubChem CID | 84619631 |
| Molecular Formula | C12H13N3 |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 2-(1,5,7-trimethylbenzimidazol-2-yl)acetonitrile |
| SMILES | Cc1cc(C)c2c(c1)nc(CC#N)n2C |
| InChI | InChI=1S/C12H13N3/c1-8-6-9(2)12-10(7-8)14-11(4-5-13)15(12)3/h6-7H,4H2,1-3H3 |
| InChIKey | LJCDJZJKISROSW-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |