C14H15N5O — CID 84641253
2-(aminomethyl)-7-methoxy-9-methylpyrimido[4,5-b]quinolin-4-amine (PubChem CID 84641253) has the molecular formula C14H15N5O and a molecular weight of 269.31 g/mol. Its IUPAC name is 2-(aminomethyl)-7-methoxy-9-methylpyrimido[4,5-b]quinolin-4-amine.
| Compound Name | 2-(aminomethyl)-7-methoxy-9-methylpyrimido[4,5-b]quinolin-4-amine |
|---|---|
| PubChem CID | 84641253 |
| Molecular Formula | C14H15N5O |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 2-(aminomethyl)-7-methoxy-9-methylpyrimido[4,5-b]quinolin-4-amine |
| SMILES | COc1cc(C)c2nc3nc(CN)nc(N)c3cc2c1 |
| InChI | InChI=1S/C14H15N5O/c1-7-3-9(20-2)4-8-5-10-13(16)17-11(6-15)18-14(10)19-12(7)8/h3-5H,6,15H2,1-2H3,(H2,16,17,18,19) |
| InChIKey | ZAWSBMLZWFWIOP-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 99.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|