C18H18BrN3O2 — CID 163213187
2-[(2-bromo-4,6-dimethoxyphenyl)methyl]-8-methylquinazolin-4-amine (PubChem CID 163213187) has the molecular formula C18H18BrN3O2 and a molecular weight of 388.27 g/mol. Its IUPAC name is 2-[(2-bromo-4,6-dimethoxyphenyl)methyl]-8-methylquinazolin-4-amine.
| Compound Name | 2-[(2-bromo-4,6-dimethoxyphenyl)methyl]-8-methylquinazolin-4-amine |
|---|---|
| PubChem CID | 163213187 |
| Molecular Formula | C18H18BrN3O2 |
| Molecular Weight | 388.27 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | 2-[(2-bromo-4,6-dimethoxyphenyl)methyl]-8-methylquinazolin-4-amine |
| SMILES | COc1cc(Br)c(Cc2nc(N)c3cccc(C)c3n2)c(OC)c1 |
| InChI | InChI=1S/C18H18BrN3O2/c1-10-5-4-6-12-17(10)21-16(22-18(12)20)9-13-14(19)7-11(23-2)8-15(13)24-3/h4-8H,9H2,1-3H3,(H2,20,21,22) |
| InChIKey | GBNAEUKFNVMXKM-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.27 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |