C10H11BrN2S — CID 84641537
1-(4-bromo-6-methyl-1,3-benzothiazol-2-yl)ethanamine (PubChem CID 84641537) has the molecular formula C10H11BrN2S and a molecular weight of 271.18 g/mol. Its IUPAC name is 1-(4-bromo-6-methyl-1,3-benzothiazol-2-yl)ethanamine.
| Compound Name | 1-(4-bromo-6-methyl-1,3-benzothiazol-2-yl)ethanamine |
|---|---|
| PubChem CID | 84641537 |
| Molecular Formula | C10H11BrN2S |
| Molecular Weight | 271.18 g/mol |
| Exact Mass | 269.98 |
| IUPAC Name | 1-(4-bromo-6-methyl-1,3-benzothiazol-2-yl)ethanamine |
| SMILES | Cc1cc(Br)c2nc(C(C)N)sc2c1 |
| InChI | InChI=1S/C10H11BrN2S/c1-5-3-7(11)9-8(4-5)14-10(13-9)6(2)12/h3-4,6H,12H2,1-2H3 |
| InChIKey | DYWSSCZGYCCEBO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.18 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |